Products 335458-65-6
CAS 335458-65-6 is the registry number for PD-217014. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-[(1S,5R)-3-(aminomethyl)-3-bicyclo[3.2.0]heptanyl]acetic acid (CAS 335458-65-6) is a chemical compound with the molecular formula C10H17NO2 and a molecular weight of 183.25 g/mol. IUPAC name: 2-[(1S,5R)-3-(aminomethyl)-3-bicyclo[3.2.0]heptanyl]acetic acid. InChIKey: NDDZVQRQVFTNSN-JWHQNHQBSA-N.
| Molecular formula | C10H17NO2 |
|---|---|
| Molecular weight | 183.25 g/mol |
| IUPAC name | 2-[(1S,5R)-3-(aminomethyl)-3-bicyclo[3.2.0]heptanyl]acetic acid |
| InChIKey | NDDZVQRQVFTNSN-JWHQNHQBSA-N |
| SMILES | C1C[C@@H]2[C@H]1CC(C2)(CC(=O)O)CN |
Computed by PubChem (NCBI)