CAS 336185-30-9 is the registry number for Ethyl cis-2-isothiocyanato-1-cyclohexanecarboxylate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Cis-ethyl (1R,2S)-2-isothiocyanatocyclohexane-1-carboxylate (CAS 336185-30-9) is a chemical compound with the molecular formula C10H15NO2S and a molecular weight of 213.30 g/mol. IUPAC name: cis-ethyl (1R,2S)-2-isothiocyanatocyclohexane-1-carboxylate. InChIKey: AIKOBLQGXOVNNL-BDAKNGLRSA-N.
| Molecular formula | C10H15NO2S |
|---|---|
| Molecular weight | 213.30 g/mol |
| IUPAC name | cis-ethyl (1R,2S)-2-isothiocyanatocyclohexane-1-carboxylate |
| InChIKey | AIKOBLQGXOVNNL-BDAKNGLRSA-N |
| SMILES | CCOC(=O)[C@@H]1CCCC[C@@H]1N=C=S |
Computed by PubChem (NCBI)