CAS 336817-91-5 is the registry number for Boc-α-(4-bromobenzyl)-DL-Pro-OH, 98%, 98%. Offered by: Chemat. Available pack sizes: 25mg, 100mg, 500mg.
2-[(4-bromophenyl)methyl]-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylic acid (CAS 336817-91-5) is a chemical compound with the molecular formula C17H22BrNO4 and a molecular weight of 384.3 g/mol. IUPAC name: 2-[(4-bromophenyl)methyl]-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylic acid. InChIKey: VQWRXYZZPMLJRL-UHFFFAOYSA-N.
| Molecular formula | C17H22BrNO4 |
|---|---|
| Molecular weight | 384.3 g/mol |
| IUPAC name | 2-[(4-bromophenyl)methyl]-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylic acid |
| InChIKey | VQWRXYZZPMLJRL-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCCC1(CC2=CC=C(C=C2)Br)C(=O)O |
Computed by PubChem (NCBI)