CAS 874162-95-5 is the registry number for (2S,4S)-2-Benzyl 1-tert-butyl 4-bromopyrrolidine-1,2-dicarboxylate, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
2-O-benzyl 1-O-tert-butyl (2S,4S)-4-bromopyrrolidine-1,2-dicarboxylate (CAS 874162-95-5) is a chemical compound with the molecular formula C17H22BrNO4 and a molecular weight of 384.3 g/mol. IUPAC name: 2-O-benzyl 1-O-tert-butyl (2S,4S)-4-bromopyrrolidine-1,2-dicarboxylate. InChIKey: BZRCQFJSGVBVKN-KBPBESRZSA-N.
| Molecular formula | C17H22BrNO4 |
|---|---|
| Molecular weight | 384.3 g/mol |
| IUPAC name | 2-O-benzyl 1-O-tert-butyl (2S,4S)-4-bromopyrrolidine-1,2-dicarboxylate |
| InChIKey | BZRCQFJSGVBVKN-KBPBESRZSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@H](C[C@H]1C(=O)OCC2=CC=CC=C2)Br |
Computed by PubChem (NCBI)