Products 337463-82-8
CAS 337463-82-8 appears in our catalog under these names: 2,2,6-TRIMETHYL-2H-PYRIDO[3,2-B][1,4]OXAZIN-3(4H)-ONE, 96%, 96%, 2,2,6-TRIMETHYL-2H-PYRIDO[3,2-B][1,4]OXAZIN-3(4H)-ONE, 96%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
2,2,6-trimethyl-4H-pyrido[3,2-b][1,4]oxazin-3-one (CAS 337463-82-8) is a chemical compound with the molecular formula C10H12N2O2 and a molecular weight of 192.21 g/mol. IUPAC name: 2,2,6-trimethyl-4H-pyrido[3,2-b][1,4]oxazin-3-one. InChIKey: JPTIZBRFAGTZBW-UHFFFAOYSA-N.
| Molecular formula | C10H12N2O2 |
|---|---|
| Molecular weight | 192.21 g/mol |
| IUPAC name | 2,2,6-trimethyl-4H-pyrido[3,2-b][1,4]oxazin-3-one |
| InChIKey | JPTIZBRFAGTZBW-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(C=C1)OC(C(=O)N2)(C)C |
Computed by PubChem (NCBI)