CAS 338392-04-4 is the registry number for 1-(3-Bromophenyl)-3,3-dimethyl-2-azetanone, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
1-(3-bromophenyl)-3,3-dimethylazetidin-2-one (CAS 338392-04-4) is a chemical compound with the molecular formula C11H12BrNO and a molecular weight of 254.12 g/mol. IUPAC name: 1-(3-bromophenyl)-3,3-dimethylazetidin-2-one. InChIKey: ZOVGIJCGWKYQCT-UHFFFAOYSA-N.
| Molecular formula | C11H12BrNO |
|---|---|
| Molecular weight | 254.12 g/mol |
| IUPAC name | 1-(3-bromophenyl)-3,3-dimethylazetidin-2-one |
| InChIKey | ZOVGIJCGWKYQCT-UHFFFAOYSA-N |
| SMILES | CC1(CN(C1=O)C2=CC(=CC=C2)Br)C |
Computed by PubChem (NCBI)