CAS 338959-87-8 is the registry number for (2E)-3-[(3,5-Dichlorophenyl)amino]prop-2-enenitrile, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
(E)-3-(3,5-dichloroanilino)prop-2-enenitrile (CAS 338959-87-8) is a chemical compound with the molecular formula C9H6Cl2N2 and a molecular weight of 213.06 g/mol. IUPAC name: (E)-3-(3,5-dichloroanilino)prop-2-enenitrile. InChIKey: UYQNIVWDDDRFKP-HNQUOIGGSA-N.
| Molecular formula | C9H6Cl2N2 |
|---|---|
| Molecular weight | 213.06 g/mol |
| IUPAC name | (E)-3-(3,5-dichloroanilino)prop-2-enenitrile |
| InChIKey | UYQNIVWDDDRFKP-HNQUOIGGSA-N |
| SMILES | C1=C(C=C(C=C1Cl)Cl)N/C=C/C#N |
Computed by PubChem (NCBI)