Products 339-34-4
CAS 339-34-4 appears in our catalog under these names: 3-(4-Fluorophenyl)-3-methylbutanoic acid, 3-(4-Fluorophenyl)-3-methylbutanoic acid, 95%, 3-(4-Fluorophenyl)-3-methylbutanoic acid, 98%, 3-(4-Fluorophenyl)-3-methylbutanoic acid, 97%, 3-(4-Fluorophenyl)-3-methylbutanoic acid, 97%, 97%. Offered by: Biosynth, Combi-blocks, AmBeed, Fluorochem, Chemat. Available pack sizes: 2,5g, 250mg, 1g, 100mg, 5g, 10g.
3-(4-fluorophenyl)-3-methylbutanoic acid (CAS 339-34-4) is a chemical compound with the molecular formula C11H13FO2 and a molecular weight of 196.22 g/mol. IUPAC name: 3-(4-fluorophenyl)-3-methylbutanoic acid. InChIKey: HDBUHVALFKKGSF-UHFFFAOYSA-N.
| Molecular formula | C11H13FO2 |
|---|---|
| Molecular weight | 196.22 g/mol |
| IUPAC name | 3-(4-fluorophenyl)-3-methylbutanoic acid |
| InChIKey | HDBUHVALFKKGSF-UHFFFAOYSA-N |
| SMILES | CC(C)(CC(=O)O)C1=CC=C(C=C1)F |
Computed by PubChem (NCBI)