CAS 3398-68-3 appears in our catalog under these names: PMMA Hydrochloride, PMMA Hydrochloride (1mg/ml in Acetonitrile), d,l-PMMA.HCl, d,l-PMMA.HCl, 1mg/ml in Methanol (as free base), PMMA HCl (p-Methoxymethamphetamine Hydrochloride). Offered by: TRC, Lipomed, LoGiCal, Biosynth. Available pack sizes: 10mg, 50mg, 5x1ml, 100mg, 1ml, 25mg.
1-(4-methoxyphenyl)-N-methylpropan-2-amine;hydrochloride (CAS 3398-68-3) is a chemical compound with the molecular formula C11H18ClNO and a molecular weight of 215.72 g/mol. IUPAC name: 1-(4-methoxyphenyl)-N-methylpropan-2-amine;hydrochloride. InChIKey: IQZVXWOBOYTPER-UHFFFAOYSA-N.
| Molecular formula | C11H18ClNO |
|---|---|
| Molecular weight | 215.72 g/mol |
| IUPAC name | 1-(4-methoxyphenyl)-N-methylpropan-2-amine;hydrochloride |
| InChIKey | IQZVXWOBOYTPER-UHFFFAOYSA-N |
| SMILES | CC(CC1=CC=C(C=C1)OC)NC.Cl |
Computed by PubChem (NCBI)