Products 3405-93-4

CAS 3405-93-4 is the registry number for Eletriptan Impurity 5. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.

2-(benzenesulfonyl)-N,N-dimethylethanamine (CAS 3405-93-4) is a chemical compound with the molecular formula C10H15NO2S and a molecular weight of 213.30 g/mol. IUPAC name: 2-(benzenesulfonyl)-N,N-dimethylethanamine. InChIKey: JWDDTXKJYCAQLI-UHFFFAOYSA-N.

Identity
Molecular formulaC10H15NO2S
Molecular weight213.30 g/mol
IUPAC name2-(benzenesulfonyl)-N,N-dimethylethanamine
InChIKeyJWDDTXKJYCAQLI-UHFFFAOYSA-N
SMILESCN(C)CCS(=O)(=O)C1=CC=CC=C1

Computed by PubChem (NCBI)