CAS 3407-93-0 is the registry number for 9-Hydrazinoacridine, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 250mg, 1g.
Acridin-9-ylhydrazine (CAS 3407-93-0) is a chemical compound with the molecular formula C13H11N3 and a molecular weight of 209.25 g/mol. IUPAC name: acridin-9-ylhydrazine. InChIKey: SVANEUDZNISLJD-UHFFFAOYSA-N.
| Molecular formula | C13H11N3 |
|---|---|
| Molecular weight | 209.25 g/mol |
| IUPAC name | acridin-9-ylhydrazine |
| InChIKey | SVANEUDZNISLJD-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=C3C=CC=CC3=N2)NN |
Computed by PubChem (NCBI)