Products 34172-21-9
CAS 34172-21-9 appears in our catalog under these names: p-Azoxyanisole-d6 (O,O-dimethyl-d6), 98 atom % D, min 98% Chemical Purity, p-Azoxyanisole-d6. Offered by: CDN, MedChemExpress. Available pack sizes: 0,5g, 0,25g, 1 mg.
Oxido-[4-(trideuteriomethoxy)phenyl]-[4-(trideuteriomethoxy)phenyl]iminoazanium (CAS 34172-21-9) is a chemical compound with the molecular formula C14H14N2O3 and a molecular weight of 264.31 g/mol. IUPAC name: oxido-[4-(trideuteriomethoxy)phenyl]-[4-(trideuteriomethoxy)phenyl]iminoazanium. InChIKey: KAEZRSFWWCTVNP-WFGJKAKNSA-N.
| Molecular formula | C14H14N2O3 |
|---|---|
| Molecular weight | 264.31 g/mol |
| IUPAC name | oxido-[4-(trideuteriomethoxy)phenyl]-[4-(trideuteriomethoxy)phenyl]iminoazanium |
| InChIKey | KAEZRSFWWCTVNP-WFGJKAKNSA-N |
| SMILES | [2H]C([2H])([2H])OC1=CC=C(C=C1)N=[N+](C2=CC=C(C=C2)OC([2H])([2H])[2H])[O-] |
Computed by PubChem (NCBI)