Products 34293-09-9
CAS 34293-09-9 is the registry number for 5,6-Dimethoxy-2-isopropenylbenzofuran. Offered by: MedChemExpress. Available pack sizes: Get quote.
5,6-dimethoxy-2-prop-1-en-2-yl-1-benzofuran (CAS 34293-09-9) is a chemical compound with the molecular formula C13H14O3 and a molecular weight of 218.25 g/mol. IUPAC name: 5,6-dimethoxy-2-prop-1-en-2-yl-1-benzofuran. InChIKey: QKZBZZKLSFFYAH-UHFFFAOYSA-N.
| Molecular formula | C13H14O3 |
|---|---|
| Molecular weight | 218.25 g/mol |
| IUPAC name | 5,6-dimethoxy-2-prop-1-en-2-yl-1-benzofuran |
| InChIKey | QKZBZZKLSFFYAH-UHFFFAOYSA-N |
| SMILES | CC(=C)C1=CC2=CC(=C(C=C2O1)OC)OC |
Computed by PubChem (NCBI)