CAS 343569-94-8 is the registry number for Dimethyl[(E)-2-(3-nitropyridin-2-yl)ethenyl]amine, 98%. Offered by: Combi-blocks. Available pack sizes: 10g, 1g, 5g.
(E)-N,N-dimethyl-2-(3-nitro-2-pyridinyl)ethenamine (CAS 343569-94-8) is a chemical compound with the molecular formula C9H11N3O2 and a molecular weight of 193.20 g/mol. IUPAC name: (E)-N,N-dimethyl-2-(3-nitro-2-pyridinyl)ethenamine. InChIKey: RQSUTXCBSMADJU-FNORWQNLSA-N.
| Molecular formula | C9H11N3O2 |
|---|---|
| Molecular weight | 193.20 g/mol |
| IUPAC name | (E)-N,N-dimethyl-2-(3-nitro-2-pyridinyl)ethenamine |
| InChIKey | RQSUTXCBSMADJU-FNORWQNLSA-N |
| SMILES | CN(C)/C=C/C1=C(C=CC=N1)[N+](=O)[O-] |
Computed by PubChem (NCBI)