CAS 343604-08-0 appears in our catalog under these names: 3-([3-(Trifluoromethyl)benzyl]oxy)benzaldehyde, 95%, 3-((3-(Trifluoromethyl)benzyl)oxy)benzaldehyde, 98+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 25g, 10g, 5g.
3-[[3-(trifluoromethyl)phenyl]methoxy]benzaldehyde (CAS 343604-08-0) is a chemical compound with the molecular formula C15H11F3O2 and a molecular weight of 280.24 g/mol. IUPAC name: 3-[[3-(trifluoromethyl)phenyl]methoxy]benzaldehyde. InChIKey: OXBDHTPFAFXIEA-UHFFFAOYSA-N.
| Molecular formula | C15H11F3O2 |
|---|---|
| Molecular weight | 280.24 g/mol |
| IUPAC name | 3-[[3-(trifluoromethyl)phenyl]methoxy]benzaldehyde |
| InChIKey | OXBDHTPFAFXIEA-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C(F)(F)F)COC2=CC=CC(=C2)C=O |
Computed by PubChem (NCBI)