CAS 34370-71-3 is the registry number for (E)-3-(4-Bromophenyl)-N,N-dimethylacrylamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(E)-3-(4-bromophenyl)-N,N-dimethylprop-2-enamide (CAS 34370-71-3) is a chemical compound with the molecular formula C11H12BrNO and a molecular weight of 254.12 g/mol. IUPAC name: (E)-3-(4-bromophenyl)-N,N-dimethylprop-2-enamide. InChIKey: ZESQHCHWETWKBZ-VMPITWQZSA-N.
| Molecular formula | C11H12BrNO |
|---|---|
| Molecular weight | 254.12 g/mol |
| IUPAC name | (E)-3-(4-bromophenyl)-N,N-dimethylprop-2-enamide |
| InChIKey | ZESQHCHWETWKBZ-VMPITWQZSA-N |
| SMILES | CN(C)C(=O)/C=C/C1=CC=C(C=C1)Br |
Computed by PubChem (NCBI)