Products 34385-94-9
CAS 34385-94-9 appears in our catalog under these names: 5-Chloro-2,3-dihydro-benzofuran-2-carboxylic acid, 96%, 5-Chloro-2,3-dihydrobenzofuran-2-carboxylic acid, 5-Chloro-2,3-dihydrobenzofuran-2-carboxylic acid, 98+%, 5-Chloro-2,3-dihydro-benzofuran-2-carboxylic acid, 98+%. Offered by: Combi-blocks, Biosynth, Ambeed, Chemat, BLDpharm. Available pack sizes: 5g, 10g, 250mg, 1g, 2,5g, 100mg.
5-chloro-2,3-dihydro-1-benzofuran-2-carboxylic acid (CAS 34385-94-9) is a chemical compound with the molecular formula C9H7ClO3 and a molecular weight of 198.60 g/mol. IUPAC name: 5-chloro-2,3-dihydro-1-benzofuran-2-carboxylic acid. InChIKey: DVOUUBIBLOOFKC-UHFFFAOYSA-N.
| Molecular formula | C9H7ClO3 |
|---|---|
| Molecular weight | 198.60 g/mol |
| IUPAC name | 5-chloro-2,3-dihydro-1-benzofuran-2-carboxylic acid |
| InChIKey | DVOUUBIBLOOFKC-UHFFFAOYSA-N |
| SMILES | C1C(OC2=C1C=C(C=C2)Cl)C(=O)O |
Computed by PubChem (NCBI)