CAS 343856-62-2 appears in our catalog under these names: 2-Chloro-6-piperidin-1-yl-pyrazine, 97%, 2-Chloro-6-(piperidin-1-yl)pyrazine, 98%, 98%. Offered by: Fluorochem, Chemat. Available pack sizes: 250mg, 1g, 5g.
2-chloro-6-piperidin-1-ylpyrazine (CAS 343856-62-2) is a chemical compound with the molecular formula C9H12ClN3 and a molecular weight of 197.66 g/mol. IUPAC name: 2-chloro-6-piperidin-1-ylpyrazine. InChIKey: KPEYFRURKBQSGA-UHFFFAOYSA-N.
| Molecular formula | C9H12ClN3 |
|---|---|
| Molecular weight | 197.66 g/mol |
| IUPAC name | 2-chloro-6-piperidin-1-ylpyrazine |
| InChIKey | KPEYFRURKBQSGA-UHFFFAOYSA-N |
| SMILES | C1CCN(CC1)C2=CN=CC(=N2)Cl |
Computed by PubChem (NCBI)