CAS 343857-09-0 appears in our catalog under these names: 1,1-Dimethylindan-5-carboxaldehyde, 95%, 1,1-Dimethylindan-5-carboxaldehyde. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
1,1-dimethyl-2,3-dihydroindene-5-carbaldehyde (CAS 343857-09-0) is a chemical compound with the molecular formula C12H14O and a molecular weight of 174.24 g/mol. IUPAC name: 1,1-dimethyl-2,3-dihydroindene-5-carbaldehyde. InChIKey: HZDXYCHIJMRKPB-UHFFFAOYSA-N.
| Molecular formula | C12H14O |
|---|---|
| Molecular weight | 174.24 g/mol |
| IUPAC name | 1,1-dimethyl-2,3-dihydroindene-5-carbaldehyde |
| InChIKey | HZDXYCHIJMRKPB-UHFFFAOYSA-N |
| SMILES | CC1(CCC2=C1C=CC(=C2)C=O)C |
Computed by PubChem (NCBI)