CAS 343944-90-1 is the registry number for 5-Methanesulfonyl-1,2,3,4-tetrahydroquinoline. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
5-methylsulfonyl-1,2,3,4-tetrahydroquinoline (CAS 343944-90-1) is a chemical compound with the molecular formula C10H13NO2S and a molecular weight of 211.28 g/mol. IUPAC name: 5-methylsulfonyl-1,2,3,4-tetrahydroquinoline. InChIKey: VGZQOVHPVJSTCE-UHFFFAOYSA-N.
| Molecular formula | C10H13NO2S |
|---|---|
| Molecular weight | 211.28 g/mol |
| IUPAC name | 5-methylsulfonyl-1,2,3,4-tetrahydroquinoline |
| InChIKey | VGZQOVHPVJSTCE-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=CC=CC2=C1CCCN2 |
Computed by PubChem (NCBI)