CAS 343962-74-3 appears in our catalog under these names: H-Pro-Oipr.HCl, 98%, Propan-2-yl (2R)-pyrrolidine-2-carboxylate hydrochloride, H-Pro-Oipr.HCl, 98%, 98%, (R)-Isopropyl pyrrolidine-2-carboxylate hydrochloride, 98%. Offered by: AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 10g, 5g, 100mg, 1g, 250mg.
Propan-2-yl (2R)-pyrrolidine-2-carboxylate;hydrochloride (CAS 343962-74-3) is a chemical compound with the molecular formula C8H16ClNO2 and a molecular weight of 193.67 g/mol. IUPAC name: propan-2-yl (2R)-pyrrolidine-2-carboxylate;hydrochloride. InChIKey: ZTZSUYHZQHGYOD-OGFXRTJISA-N.
| Molecular formula | C8H16ClNO2 |
|---|---|
| Molecular weight | 193.67 g/mol |
| IUPAC name | propan-2-yl (2R)-pyrrolidine-2-carboxylate;hydrochloride |
| InChIKey | ZTZSUYHZQHGYOD-OGFXRTJISA-N |
| SMILES | CC(C)OC(=O)[C@H]1CCCN1.Cl |
Computed by PubChem (NCBI)