Products 34425-64-4
CAS 34425-64-4 is the registry number for Hydrocotoin, 90.0%. Offered by: MedChemExpress. Available pack sizes: 1 mg.
(2-hydroxy-4,6-dimethoxyphenyl)-phenylmethanone (CAS 34425-64-4) is a chemical compound with the molecular formula C15H14O4 and a molecular weight of 258.27 g/mol. IUPAC name: (2-hydroxy-4,6-dimethoxyphenyl)-phenylmethanone. InChIKey: RVXZNIXBABAEQZ-UHFFFAOYSA-N.
| Molecular formula | C15H14O4 |
|---|---|
| Molecular weight | 258.27 g/mol |
| IUPAC name | (2-hydroxy-4,6-dimethoxyphenyl)-phenylmethanone |
| InChIKey | RVXZNIXBABAEQZ-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C(=C1)OC)C(=O)C2=CC=CC=C2)O |
Computed by PubChem (NCBI)