CAS 344595-77-3 appears in our catalog under these names: Methyl 2,3-diamino-4,6-dimethylbenzoate, 97%, Methyl 2,3-diamino-4,6-dimethylbenzoate, 98%, 98%, Methyl 2,3-diamino-4,6-dimethylbenzoate, 98%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 100mg.
Methyl 2,3-diamino-4,6-dimethylbenzoate (CAS 344595-77-3) is a chemical compound with the molecular formula C10H14N2O2 and a molecular weight of 194.23 g/mol. IUPAC name: methyl 2,3-diamino-4,6-dimethylbenzoate. InChIKey: MXEVXNHGOSYLAF-UHFFFAOYSA-N.
| Molecular formula | C10H14N2O2 |
|---|---|
| Molecular weight | 194.23 g/mol |
| IUPAC name | methyl 2,3-diamino-4,6-dimethylbenzoate |
| InChIKey | MXEVXNHGOSYLAF-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1C(=O)OC)N)N)C |
Computed by PubChem (NCBI)