CAS 344936-66-9 is the registry number for Ethyl 6-hydroxy-1-methyl-1H-indole-2-carboxylate. Offered by: Biosynth. Available pack sizes: 250mg.
Ethyl 6-hydroxy-1-methylindole-2-carboxylate (CAS 344936-66-9) is a chemical compound with the molecular formula C12H13NO3 and a molecular weight of 219.24 g/mol. IUPAC name: ethyl 6-hydroxy-1-methylindole-2-carboxylate. InChIKey: XYFONSKUOHELDG-UHFFFAOYSA-N.
| Molecular formula | C12H13NO3 |
|---|---|
| Molecular weight | 219.24 g/mol |
| IUPAC name | ethyl 6-hydroxy-1-methylindole-2-carboxylate |
| InChIKey | XYFONSKUOHELDG-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC2=C(N1C)C=C(C=C2)O |
Computed by PubChem (NCBI)