CAS 34586-44-2 is the registry number for 3-Ethylbenzene-1-sulfonyl chloride. Offered by: Biosynth. Available pack sizes: 50mg.
3-ethylbenzenesulfonyl chloride (CAS 34586-44-2) is a chemical compound with the molecular formula C8H9ClO2S and a molecular weight of 204.67 g/mol. IUPAC name: 3-ethylbenzenesulfonyl chloride. InChIKey: VIVGANIZOCUFFE-UHFFFAOYSA-N.
| Molecular formula | C8H9ClO2S |
|---|---|
| Molecular weight | 204.67 g/mol |
| IUPAC name | 3-ethylbenzenesulfonyl chloride |
| InChIKey | VIVGANIZOCUFFE-UHFFFAOYSA-N |
| SMILES | CCC1=CC(=CC=C1)S(=O)(=O)Cl |
Computed by PubChem (NCBI)