CAS 345893-27-8 appears in our catalog under these names: Tert-butyl (4-chloro-3-hydroxyphenyl)carbamate, 98%, 98%, (4-Chloro-3-hydroxy-phenyl)-carbamic acid tert-butyl ester, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g, 500mg.
Tert-butyl N-(4-chloro-3-hydroxyphenyl)carbamate (CAS 345893-27-8) is a chemical compound with the molecular formula C11H14ClNO3 and a molecular weight of 243.68 g/mol. IUPAC name: tert-butyl N-(4-chloro-3-hydroxyphenyl)carbamate. InChIKey: BWJHNIPKQFCYIS-UHFFFAOYSA-N.
| Molecular formula | C11H14ClNO3 |
|---|---|
| Molecular weight | 243.68 g/mol |
| IUPAC name | tert-butyl N-(4-chloro-3-hydroxyphenyl)carbamate |
| InChIKey | BWJHNIPKQFCYIS-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=CC(=C(C=C1)Cl)O |
Computed by PubChem (NCBI)