Products 345983-26-8
CAS 345983-26-8 is the registry number for 2-(1-Chlorocyclopropyl)-1-(2-chlorophenyl)-3-hydrazineylpropan-2-ol hydrochloride, 95%. Offered by: Chemat. Available pack sizes: 5mg, 10mg, 25mg.
2-(1-chlorocyclopropyl)-1-(2-chlorophenyl)-3-hydrazinylpropan-2-ol;hydrochloride (CAS 345983-26-8) is a chemical compound with the molecular formula C12H17Cl3N2O and a molecular weight of 311.6 g/mol. IUPAC name: 2-(1-chlorocyclopropyl)-1-(2-chlorophenyl)-3-hydrazinylpropan-2-ol;hydrochloride. InChIKey: JFINMVQBTQJRQM-UHFFFAOYSA-N.
| Molecular formula | C12H17Cl3N2O |
|---|---|
| Molecular weight | 311.6 g/mol |
| IUPAC name | 2-(1-chlorocyclopropyl)-1-(2-chlorophenyl)-3-hydrazinylpropan-2-ol;hydrochloride |
| InChIKey | JFINMVQBTQJRQM-UHFFFAOYSA-N |
| SMILES | C1CC1(C(CC2=CC=CC=C2Cl)(CNN)O)Cl.Cl |
Computed by PubChem (NCBI)