CAS 3464-18-4 appears in our catalog under these names: 3-Phenylpyrrolidine-2,5-dione, 95%, 2,5–Pyrrolidinedione, 3–phenyl–, 3-Phenylpyrrolidine-2,5-dione, 3-Phenylpyrrolidine-2,5-dione 98%, 3-Phenylpyrrolidine-2,5-dione, 98%, 98%. Offered by: Combi-blocks, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 250mg, 1g, 100mg, 2,5g.
3-phenylpyrrolidine-2,5-dione (CAS 3464-18-4) is a chemical compound with the molecular formula C10H9NO2 and a molecular weight of 175.18 g/mol. IUPAC name: 3-phenylpyrrolidine-2,5-dione. InChIKey: FVSWNQYFMNGPLF-UHFFFAOYSA-N.
| Molecular formula | C10H9NO2 |
|---|---|
| Molecular weight | 175.18 g/mol |
| IUPAC name | 3-phenylpyrrolidine-2,5-dione |
| InChIKey | FVSWNQYFMNGPLF-UHFFFAOYSA-N |
| SMILES | C1C(C(=O)NC1=O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)