Products 346434-45-5
CAS 346434-45-5 appears in our catalog under these names: 2–Hydroxyl emodin–1–methyl ether, 2-Hydroxyl emodin-1-methyl ether, ≥98%, ≥98%, 2-Hydroxyl emodin-1-methyl ether, 98.87%. Offered by: GLPBio, Chemat, MedChemExpress. Available pack sizes: 5mg, 10mg, 20mg, 50mg, 100mg, 5 mg, 1 mg.
2,6,8-trihydroxy-1-methoxy-3-methylanthracene-9,10-dione (CAS 346434-45-5) is a chemical compound with the molecular formula C16H12O6 and a molecular weight of 300.26 g/mol. IUPAC name: 2,6,8-trihydroxy-1-methoxy-3-methylanthracene-9,10-dione. InChIKey: JGWNHIDADWFGIJ-UHFFFAOYSA-N.
| Molecular formula | C16H12O6 |
|---|---|
| Molecular weight | 300.26 g/mol |
| IUPAC name | 2,6,8-trihydroxy-1-methoxy-3-methylanthracene-9,10-dione |
| InChIKey | JGWNHIDADWFGIJ-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C(=C1O)OC)C(=O)C3=C(C2=O)C=C(C=C3O)O |
Computed by PubChem (NCBI)