CAS 34668-29-6 appears in our catalog under these names: 5-nitrofuro(2,3-b)pyridine, 98%, 5-Nitrofuro[2,3-b]pyridine, 98%, 98%, 5-Nitrofuro[2,3-b]pyridine, 98%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 100mg.
5-nitrofuro[2,3-b]pyridine (CAS 34668-29-6) is a chemical compound with the molecular formula C7H4N2O3 and a molecular weight of 164.12 g/mol. IUPAC name: 5-nitrofuro[2,3-b]pyridine. InChIKey: UHZSTGZOKUNPJH-UHFFFAOYSA-N.
| Molecular formula | C7H4N2O3 |
|---|---|
| Molecular weight | 164.12 g/mol |
| IUPAC name | 5-nitrofuro[2,3-b]pyridine |
| InChIKey | UHZSTGZOKUNPJH-UHFFFAOYSA-N |
| SMILES | C1=COC2=NC=C(C=C21)[N+](=O)[O-] |
Computed by PubChem (NCBI)