Products 346691-54-1
CAS 346691-54-1 is the registry number for BCN512, 99.75%. Offered by: MedChemExpress. Available pack sizes: 1 mg.
1-(4-nitrophenyl)sulfonyl-4-phenylpiperazine (CAS 346691-54-1) is a chemical compound with the molecular formula C16H17N3O4S and a molecular weight of 347.4 g/mol. IUPAC name: 1-(4-nitrophenyl)sulfonyl-4-phenylpiperazine. InChIKey: XODLTOYHPDBTRW-UHFFFAOYSA-N.
| Molecular formula | C16H17N3O4S |
|---|---|
| Molecular weight | 347.4 g/mol |
| IUPAC name | 1-(4-nitrophenyl)sulfonyl-4-phenylpiperazine |
| InChIKey | XODLTOYHPDBTRW-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1C2=CC=CC=C2)S(=O)(=O)C3=CC=C(C=C3)[N+](=O)[O-] |
Computed by PubChem (NCBI)