CAS 346704-91-4 is the registry number for Methyl 5-amino-2-phenoxybenzoate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
Methyl 5-amino-2-phenoxybenzoate (CAS 346704-91-4) is a chemical compound with the molecular formula C14H13NO3 and a molecular weight of 243.26 g/mol. IUPAC name: methyl 5-amino-2-phenoxybenzoate. InChIKey: MHAZEXGQGPSXRT-UHFFFAOYSA-N.
| Molecular formula | C14H13NO3 |
|---|---|
| Molecular weight | 243.26 g/mol |
| IUPAC name | methyl 5-amino-2-phenoxybenzoate |
| InChIKey | MHAZEXGQGPSXRT-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=CC(=C1)N)OC2=CC=CC=C2 |
Computed by PubChem (NCBI)