Products 346721-91-3
CAS 346721-91-3 appears in our catalog under these names: (3-Bromobenzoyl)pyrrolidine, 96%, (3-Bromophenyl)(pyrrolidin-1-yl)methanone 96%. Offered by: Combi-blocks, Ambeed. Available pack sizes: 1g, 25g, 10g, 5g, 100g.
(3-bromophenyl)-pyrrolidin-1-ylmethanone (CAS 346721-91-3) is a chemical compound with the molecular formula C11H12BrNO and a molecular weight of 254.12 g/mol. IUPAC name: (3-bromophenyl)-pyrrolidin-1-ylmethanone. InChIKey: ZFWDUMGAQDJYAE-UHFFFAOYSA-N.
| Molecular formula | C11H12BrNO |
|---|---|
| Molecular weight | 254.12 g/mol |
| IUPAC name | (3-bromophenyl)-pyrrolidin-1-ylmethanone |
| InChIKey | ZFWDUMGAQDJYAE-UHFFFAOYSA-N |
| SMILES | C1CCN(C1)C(=O)C2=CC(=CC=C2)Br |
Computed by PubChem (NCBI)