CAS 346723-95-3 is the registry number for 2-Bromo-N-(5-methylisoxazol-3-yl)benzamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-bromo-N-(5-methyl-1,2-oxazol-3-yl)benzamide (CAS 346723-95-3) is a chemical compound with the molecular formula C11H9BrN2O2 and a molecular weight of 281.10 g/mol. IUPAC name: 2-bromo-N-(5-methyl-1,2-oxazol-3-yl)benzamide. InChIKey: MFCHANMAPCUMKI-UHFFFAOYSA-N.
| Molecular formula | C11H9BrN2O2 |
|---|---|
| Molecular weight | 281.10 g/mol |
| IUPAC name | 2-bromo-N-(5-methyl-1,2-oxazol-3-yl)benzamide |
| InChIKey | MFCHANMAPCUMKI-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NO1)NC(=O)C2=CC=CC=C2Br |
Computed by PubChem (NCBI)