CAS 347332-01-8 is the registry number for Methyl 4-(3-formyl-2,5-dimethyl-1h-pyrrol-1-yl)benzoate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
Methyl 4-(3-formyl-2,5-dimethylpyrrol-1-yl)benzoate (CAS 347332-01-8) is a chemical compound with the molecular formula C15H15NO3 and a molecular weight of 257.28 g/mol. IUPAC name: methyl 4-(3-formyl-2,5-dimethylpyrrol-1-yl)benzoate. InChIKey: ILWHGQULIVXXKH-UHFFFAOYSA-N.
| Molecular formula | C15H15NO3 |
|---|---|
| Molecular weight | 257.28 g/mol |
| IUPAC name | methyl 4-(3-formyl-2,5-dimethylpyrrol-1-yl)benzoate |
| InChIKey | ILWHGQULIVXXKH-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(N1C2=CC=C(C=C2)C(=O)OC)C)C=O |
Computed by PubChem (NCBI)