Products 348143-67-9
CAS 348143-67-9 appears in our catalog under these names: 2-Amino-2-(2,4-dimethoxyphenyl)acetonitrile hydrochloride, 95%, 2-Amino-2-(2,4-dimethoxyphenyl)acetonitrile hydrochloride. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 0,5g.
2-amino-2-(2,4-dimethoxyphenyl)acetonitrile;hydrochloride (CAS 348143-67-9) is a chemical compound with the molecular formula C10H13ClN2O2 and a molecular weight of 228.67 g/mol. IUPAC name: 2-amino-2-(2,4-dimethoxyphenyl)acetonitrile;hydrochloride. InChIKey: BNQHLSMBCLCAQQ-UHFFFAOYSA-N.
| Molecular formula | C10H13ClN2O2 |
|---|---|
| Molecular weight | 228.67 g/mol |
| IUPAC name | 2-amino-2-(2,4-dimethoxyphenyl)acetonitrile;hydrochloride |
| InChIKey | BNQHLSMBCLCAQQ-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1)C(C#N)N)OC.Cl |
Computed by PubChem (NCBI)