CAS 3484-22-8 appears in our catalog under these names: 5-Nitro-2,3,3-trimethylindolenine, 95%, 5-Nitro-2,3,3-trimethylindolenine, 95-<97%, 5-Nitro-2,3,3-trimethylindolenine, ≥97-<99%, 2,3,3–Trimethyl–5–nitro–3H–indole, 2,3,3-Trimethyl-5-nitro-3H-indole, 98%, 98%. Offered by: Combi-blocks, Hoffman Fine Chemicals, GLPBio, Chemat, Fluorochem. Available pack sizes: 10g, 5g, 1g, 100g, 200g, 300g, 400g, 500g.
2,3,3-trimethyl-5-nitroindole (CAS 3484-22-8) is a chemical compound with the molecular formula C11H12N2O2 and a molecular weight of 204.22 g/mol. IUPAC name: 2,3,3-trimethyl-5-nitroindole. InChIKey: DDORSJSRAREODY-UHFFFAOYSA-N.
| Molecular formula | C11H12N2O2 |
|---|---|
| Molecular weight | 204.22 g/mol |
| IUPAC name | 2,3,3-trimethyl-5-nitroindole |
| InChIKey | DDORSJSRAREODY-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(C1(C)C)C=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)