CAS 349665-92-5 appears in our catalog under these names: 4-(4-Fluorophenyl)-3-fluorophenol, 97%, 2,4'-Difluoro-[1,1'-biphenyl]-4-ol 97%. Offered by: Combi-blocks, Ambeed, Fluorochem. Available pack sizes: 1g, 250mg, 100mg, 5g.
3-fluoro-4-(4-fluorophenyl)phenol (CAS 349665-92-5) is a chemical compound with the molecular formula C12H8F2O and a molecular weight of 206.19 g/mol. IUPAC name: 3-fluoro-4-(4-fluorophenyl)phenol. InChIKey: NRBIGGXSQDASKN-UHFFFAOYSA-N.
| Molecular formula | C12H8F2O |
|---|---|
| Molecular weight | 206.19 g/mol |
| IUPAC name | 3-fluoro-4-(4-fluorophenyl)phenol |
| InChIKey | NRBIGGXSQDASKN-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=C(C=C(C=C2)O)F)F |
Computed by PubChem (NCBI)