CAS 350672-17-2 appears in our catalog under these names: 2-(Chloromethyl)-5-(2-fluorophenyl)-1,3,4-oxadiazole, 2-(Chloromethyl)-5-(2-fluorophenyl)-1,3,4-oxadiazole, 95%. Offered by: Biosynth, Combi-blocks. Available pack sizes: 250mg, 2,5g, 1g.
2-(chloromethyl)-5-(2-fluorophenyl)-1,3,4-oxadiazole (CAS 350672-17-2) is a chemical compound with the molecular formula C9H6ClFN2O and a molecular weight of 212.61 g/mol. IUPAC name: 2-(chloromethyl)-5-(2-fluorophenyl)-1,3,4-oxadiazole. InChIKey: KMTDGSLZOLNXOM-UHFFFAOYSA-N.
| Molecular formula | C9H6ClFN2O |
|---|---|
| Molecular weight | 212.61 g/mol |
| IUPAC name | 2-(chloromethyl)-5-(2-fluorophenyl)-1,3,4-oxadiazole |
| InChIKey | KMTDGSLZOLNXOM-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=NN=C(O2)CCl)F |
Computed by PubChem (NCBI)