Products 350820-13-2
CAS 350820-13-2 appears in our catalog under these names: Kynurenic-d5 Acid, Kynurenic-3,5,6,7,8-d5 Acid, 98 atom % D, min 98% Chemical Purity, Kynurenic Acid-d5, >95% (HPLC), Kynurenic acid–d5, Kynurenic acid-d5, 99.64%. Offered by: Chemat Brand, CDN, TRC, GLPBio, MedChemExpress. Available pack sizes: on request, 0,01g, 0,005g, 2,5mg, 25mg, 1mg, 5 mg.
3,5,6,7,8-pentadeuterio-4-hydroxyquinoline-2-carboxylic acid (CAS 350820-13-2) is a chemical compound with the molecular formula C10H7NO3 and a molecular weight of 194.20 g/mol. IUPAC name: 3,5,6,7,8-pentadeuterio-4-hydroxyquinoline-2-carboxylic acid. InChIKey: HCZHHEIFKROPDY-RALIUCGRSA-N.
| Molecular formula | C10H7NO3 |
|---|---|
| Molecular weight | 194.20 g/mol |
| IUPAC name | 3,5,6,7,8-pentadeuterio-4-hydroxyquinoline-2-carboxylic acid |
| InChIKey | HCZHHEIFKROPDY-RALIUCGRSA-N |
| SMILES | [2H]C1=C(C(=C2C(=C1[2H])C(=C(C(=N2)C(=O)O)[2H])O)[2H])[2H] |
Computed by PubChem (NCBI)