Products 35086-79-4
CAS 35086-79-4 is the registry number for 3-(4-Chlorophenyl)acryloyl chloride, 95%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g.
(E)-3-(4-chlorophenyl)prop-2-enoyl chloride (CAS 35086-79-4) is a chemical compound with the molecular formula C9H6Cl2O and a molecular weight of 201.05 g/mol. IUPAC name: (E)-3-(4-chlorophenyl)prop-2-enoyl chloride. InChIKey: ZFOVCSTVYYYRSU-ZZXKWVIFSA-N.
| Molecular formula | C9H6Cl2O |
|---|---|
| Molecular weight | 201.05 g/mol |
| IUPAC name | (E)-3-(4-chlorophenyl)prop-2-enoyl chloride |
| InChIKey | ZFOVCSTVYYYRSU-ZZXKWVIFSA-N |
| SMILES | C1=CC(=CC=C1/C=C/C(=O)Cl)Cl |
Computed by PubChem (NCBI)
Synonyms:
3-(4-chlorophenyl)acryloyl chloride, (E)-3-(4-chlorophenyl)prop-2-enoyl Chloride, (E)-3-(4-chlorophenyl)acryloyl chloride, p-chlorocinnamoyl chloride, (2E)-3-(4-chlorophenyl)prop-2-enoyl chloride, 2-Propenoyl chloride, 3-(4-chlorophenyl)-, (E)-, 2-Propenoyl chloride, 3-(4-chlorophenyl)-, (2E)-, (E)-4-chloro-cinnamoyl-chloride, ZFOVCSTVYYYRSU-ZZXKWVIFSA-N, (e)-4-chlorocinnamic acid chloride