CAS 351-45-1 appears in our catalog under these names: 3-Chloro-N-(2,2,2-trifluoroethyl)aniline, 3-Chloro-N-(2,2,2-trifluoroethyl)aniline, 95%, 95%, 3-Chloro-N-(2,2,2-trifluoroethyl)aniline, 95%. Offered by: Biosynth, Chemat, Fluorochem. Available pack sizes: 0,5g, 50mg, 100mg, 250mg, 1g, 5g, 500mg, 2.5g.
3-chloro-N-(2,2,2-trifluoroethyl)aniline (CAS 351-45-1) is a chemical compound with the molecular formula C8H7ClF3N and a molecular weight of 209.59 g/mol. IUPAC name: 3-chloro-N-(2,2,2-trifluoroethyl)aniline. InChIKey: RDAKJSKMJRKRQA-UHFFFAOYSA-N.
| Molecular formula | C8H7ClF3N |
|---|---|
| Molecular weight | 209.59 g/mol |
| IUPAC name | 3-chloro-N-(2,2,2-trifluoroethyl)aniline |
| InChIKey | RDAKJSKMJRKRQA-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Cl)NCC(F)(F)F |
Computed by PubChem (NCBI)