CAS 351-70-2 appears in our catalog under these names: Benzyl trifluoroacetate, 95%, Benzyl trifluoroacetate. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 5g, 1g.
Benzyl 2,2,2-trifluoroacetate (CAS 351-70-2) is a chemical compound with the molecular formula C9H7F3O2 and a molecular weight of 204.15 g/mol. IUPAC name: benzyl 2,2,2-trifluoroacetate. InChIKey: HDYQLGLEPPGPEV-UHFFFAOYSA-N.
| Molecular formula | C9H7F3O2 |
|---|---|
| Molecular weight | 204.15 g/mol |
| IUPAC name | benzyl 2,2,2-trifluoroacetate |
| InChIKey | HDYQLGLEPPGPEV-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)C(F)(F)F |
Computed by PubChem (NCBI)