CAS 351866-06-3 appears in our catalog under these names: 5-(Cyclopropylmethyl)-2,2-dimethyl-1,3-dioxane-4,6-dione, 95%, 95%, 5-(cyclopropylmethyl)-2,2-dimethyl-1,3-dioxane-4,6-dione, 95%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg.
5-(cyclopropylmethyl)-2,2-dimethyl-1,3-dioxane-4,6-dione (CAS 351866-06-3) is a chemical compound with the molecular formula C10H14O4 and a molecular weight of 198.22 g/mol. IUPAC name: 5-(cyclopropylmethyl)-2,2-dimethyl-1,3-dioxane-4,6-dione. InChIKey: JSWJNHYGPHCUMT-UHFFFAOYSA-N.
| Molecular formula | C10H14O4 |
|---|---|
| Molecular weight | 198.22 g/mol |
| IUPAC name | 5-(cyclopropylmethyl)-2,2-dimethyl-1,3-dioxane-4,6-dione |
| InChIKey | JSWJNHYGPHCUMT-UHFFFAOYSA-N |
| SMILES | CC1(OC(=O)C(C(=O)O1)CC2CC2)C |
Computed by PubChem (NCBI)