Products 352438-64-3

CAS 352438-64-3 is the registry number for (1R,2S)-(-)-Norephedrine-gamma,gamma,gamma-d3 HCl, 98 atom % D, min 98% Chemical Purity. Offered by: CDN. Available pack sizes: 0,01g.

Structural formula: {0} (CAS {1})

(1R,2S)-2-amino-3,3,3-trideuterio-1-phenylpropan-1-ol;hydrochloride (CAS 352438-64-3) is a chemical compound with the molecular formula C9H14ClNO and a molecular weight of 190.68 g/mol. IUPAC name: (1R,2S)-2-amino-3,3,3-trideuterio-1-phenylpropan-1-ol;hydrochloride. InChIKey: DYWNLSQWJMTVGJ-NPFAOLFPSA-N.

Identity
Molecular formulaC9H14ClNO
Molecular weight190.68 g/mol
IUPAC name(1R,2S)-2-amino-3,3,3-trideuterio-1-phenylpropan-1-ol;hydrochloride
InChIKeyDYWNLSQWJMTVGJ-NPFAOLFPSA-N
SMILES[2H]C([2H])([2H])[C@@H]([C@@H](C1=CC=CC=C1)O)N.Cl

Computed by PubChem (NCBI)