Products 40626-29-7
CAS 40626-29-7 is the registry number for (1S,2R)-(+)-Norephedrine HCl, min 98% Chemical Purity. Offered by: CDN. Available pack sizes: 0,1g, 0,05g.
(1S,2R)-2-amino-1-phenylpropan-1-ol;hydrochloride (CAS 40626-29-7) is a chemical compound with the molecular formula C9H14ClNO and a molecular weight of 187.66 g/mol. IUPAC name: (1S,2R)-2-amino-1-phenylpropan-1-ol;hydrochloride. InChIKey: DYWNLSQWJMTVGJ-PRCZDLBKSA-N.
| Molecular formula | C9H14ClNO |
|---|---|
| Molecular weight | 187.66 g/mol |
| IUPAC name | (1S,2R)-2-amino-1-phenylpropan-1-ol;hydrochloride |
| InChIKey | DYWNLSQWJMTVGJ-PRCZDLBKSA-N |
| SMILES | C[C@H]([C@H](C1=CC=CC=C1)O)N.Cl |
Computed by PubChem (NCBI)
Synonyms:
d-Norephedrine hydrochloride, Phenylpropanolamine hydrochloride, (+)-, (1S,2R)-(+)-Norephedrine hydrochloride, Norephedrine, hydrochloride, (+)-, (+)-Phenylpropanolamine hydrochloride, (+)-norephedrine hydrochloride, (1S,2R)-Norephedrine Hydrochloride, D-PHENYLPROPANOLAMINE HYDROCHLORIDE, PHENYLPROPANOLAMINE (+)-FORM HYDROCHLORIDE [MI], PHENYLPROPANOLAMINE (+)-FORM HYDROCHLORIDE