CAS 35249-73-1 is the registry number for Benzyl 2-chloro-2-oxoacetate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Benzyl 2-chloro-2-oxoacetate (CAS 35249-73-1) is a chemical compound with the molecular formula C9H7ClO3 and a molecular weight of 198.60 g/mol. IUPAC name: benzyl 2-chloro-2-oxoacetate. InChIKey: YOZSRQSUXWJLEU-UHFFFAOYSA-N.
| Molecular formula | C9H7ClO3 |
|---|---|
| Molecular weight | 198.60 g/mol |
| IUPAC name | benzyl 2-chloro-2-oxoacetate |
| InChIKey | YOZSRQSUXWJLEU-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)C(=O)Cl |
Computed by PubChem (NCBI)