CAS 352525-33-8 appears in our catalog under these names: 2-Pyridinepropanoic acid, α-amino-5-hydroxy-, monohydrochloride, (αS)- (9CI), 95%, 95%, (S)-2-Amino-3-(5-hydroxypyridin-2-yl)propanoic acid hydrochloride, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg.
(2S)-2-amino-3-(5-hydroxy-2-pyridinyl)propanoic acid;hydrochloride (CAS 352525-33-8) is a chemical compound with the molecular formula C8H11ClN2O3 and a molecular weight of 218.64 g/mol. IUPAC name: (2S)-2-amino-3-(5-hydroxy-2-pyridinyl)propanoic acid;hydrochloride. InChIKey: OUAAPVWXGKWWRO-FJXQXJEOSA-N.
| Molecular formula | C8H11ClN2O3 |
|---|---|
| Molecular weight | 218.64 g/mol |
| IUPAC name | (2S)-2-amino-3-(5-hydroxy-2-pyridinyl)propanoic acid;hydrochloride |
| InChIKey | OUAAPVWXGKWWRO-FJXQXJEOSA-N |
| SMILES | C1=CC(=NC=C1O)C[C@@H](C(=O)O)N.Cl |
Computed by PubChem (NCBI)