Products 352530-26-8
CAS 352530-26-8 appears in our catalog under these names: (E)-(3-Methylstyryl)boronic acid, 97%, 97%, (E)-(3-Methylstyryl)boronic acid, 97%, (E)-(3-Methylstyryl)Boronic Acid, 98%. Offered by: Chemat, Ambeed, BLDpharm, Fluorochem. Available pack sizes: 250mg, 100mg, 1g, 5g, 10g.
[(E)-2-(3-methylphenyl)ethenyl]boronic acid (CAS 352530-26-8) is a chemical compound with the molecular formula C9H11BO2 and a molecular weight of 162.00 g/mol. IUPAC name: [(E)-2-(3-methylphenyl)ethenyl]boronic acid. InChIKey: XMUZKAQIQDQNBO-AATRIKPKSA-N.
| Molecular formula | C9H11BO2 |
|---|---|
| Molecular weight | 162.00 g/mol |
| IUPAC name | [(E)-2-(3-methylphenyl)ethenyl]boronic acid |
| InChIKey | XMUZKAQIQDQNBO-AATRIKPKSA-N |
| SMILES | B(/C=C/C1=CC=CC(=C1)C)(O)O |
Computed by PubChem (NCBI)