CAS 352554-39-3 is the registry number for 3-(4-Methoxybenzoyl)-5H,6H,7H-pyrrolo(1,2-a)imidazol-2-amine. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
(2-amino-6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-3-yl)-(4-methoxyphenyl)methanone (CAS 352554-39-3) is a chemical compound with the molecular formula C14H15N3O2 and a molecular weight of 257.29 g/mol. IUPAC name: (2-amino-6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-3-yl)-(4-methoxyphenyl)methanone. InChIKey: BLKKZMGIZGGJNP-UHFFFAOYSA-N.
| Molecular formula | C14H15N3O2 |
|---|---|
| Molecular weight | 257.29 g/mol |
| IUPAC name | (2-amino-6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-3-yl)-(4-methoxyphenyl)methanone |
| InChIKey | BLKKZMGIZGGJNP-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C(=O)C2=C(N=C3N2CCC3)N |
Computed by PubChem (NCBI)